C19H20N2O5 — CID 126786953
4-[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 126786953) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | 4-[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 126786953 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | Cc1cccc(Cn2cccc(C(=O)N3CCOC(C(=O)O)C3)c2=O)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-13-4-2-5-14(10-13)11-20-7-3-6-15(17(20)22)18(23)21-8-9-26-16(12-21)19(24)25/h2-7,10,16H,8-9,11-12H2,1H3,(H,24,25) |
| InChIKey | RKTSAHNZSYILOA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |