C21H26N2O2 — CID 52539460
3-[(3S)-3-ethylpiperidine-1-carbonyl]-1-[(3-methylphenyl)methyl]pyridin-2-one (PubChem CID 52539460) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[(3S)-3-ethylpiperidine-1-carbonyl]-1-[(3-methylphenyl)methyl]pyridin-2-one.
| Compound Name | 3-[(3S)-3-ethylpiperidine-1-carbonyl]-1-[(3-methylphenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 52539460 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[(3S)-3-ethylpiperidine-1-carbonyl]-1-[(3-methylphenyl)methyl]pyridin-2-one |
| SMILES | CC[C@H]1CCCN(C(=O)c2cccn(Cc3cccc(C)c3)c2=O)C1 |
| InChI | InChI=1S/C21H26N2O2/c1-3-17-9-5-11-22(14-17)20(24)19-10-6-12-23(21(19)25)15-18-8-4-7-16(2)13-18/h4,6-8,10,12-13,17H,3,5,9,11,14-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | ACPRJDNBLGFNRZ-KRWDZBQOSA-N |
| XLogP | 3.47 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |