C15H18FNO3S — CID 126787212
5-tert-butyl-2-[1-(2-fluorophenyl)sulfonylethyl]-1,3-oxazole (PubChem CID 126787212) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-tert-butyl-2-[1-(2-fluorophenyl)sulfonylethyl]-1,3-oxazole.
| Compound Name | 5-tert-butyl-2-[1-(2-fluorophenyl)sulfonylethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 126787212 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-tert-butyl-2-[1-(2-fluorophenyl)sulfonylethyl]-1,3-oxazole |
| SMILES | CC(c1ncc(C(C)(C)C)o1)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO3S/c1-10(14-17-9-13(20-14)15(2,3)4)21(18,19)12-8-6-5-7-11(12)16/h5-10H,1-4H3 |
| InChIKey | OFXPQEXMPORHAY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |