C17H19NO3S — CID 126789375
1-(5-methoxy-3-methyl-1-benzothiophene-2-carbonyl)-3-methylpiperidin-4-one (PubChem CID 126789375) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(5-methoxy-3-methyl-1-benzothiophene-2-carbonyl)-3-methylpiperidin-4-one.
| Compound Name | 1-(5-methoxy-3-methyl-1-benzothiophene-2-carbonyl)-3-methylpiperidin-4-one |
|---|---|
| PubChem CID | 126789375 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-(5-methoxy-3-methyl-1-benzothiophene-2-carbonyl)-3-methylpiperidin-4-one |
| SMILES | COc1ccc2sc(C(=O)N3CCC(=O)C(C)C3)c(C)c2c1 |
| InChI | InChI=1S/C17H19NO3S/c1-10-9-18(7-6-14(10)19)17(20)16-11(2)13-8-12(21-3)4-5-15(13)22-16/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | FFWBKNVQBZHASM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |