C17H21NO4S2 — CID 136531563
(5-methoxy-3-methyl-1-benzothiophen-2-yl)-(3-methylsulfonylpiperidin-1-yl)methanone (PubChem CID 136531563) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is (5-methoxy-3-methyl-1-benzothiophen-2-yl)-(3-methylsulfonylpiperidin-1-yl)methanone.
| Compound Name | (5-methoxy-3-methyl-1-benzothiophen-2-yl)-(3-methylsulfonylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 136531563 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | (5-methoxy-3-methyl-1-benzothiophen-2-yl)-(3-methylsulfonylpiperidin-1-yl)methanone |
| SMILES | COc1ccc2sc(C(=O)N3CCCC(S(C)(=O)=O)C3)c(C)c2c1 |
| InChI | InChI=1S/C17H21NO4S2/c1-11-14-9-12(22-2)6-7-15(14)23-16(11)17(19)18-8-4-5-13(10-18)24(3,20)21/h6-7,9,13H,4-5,8,10H2,1-3H3 |
| InChIKey | RDXHUFHKQBKFCB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |