C20H29NO4S — CID 126789437
4-cyclopentylsulfonyl-N-[(1-methoxycyclohexyl)methyl]benzamide (PubChem CID 126789437) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-N-[(1-methoxycyclohexyl)methyl]benzamide.
| Compound Name | 4-cyclopentylsulfonyl-N-[(1-methoxycyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 126789437 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-cyclopentylsulfonyl-N-[(1-methoxycyclohexyl)methyl]benzamide |
| SMILES | COC1(CNC(=O)c2ccc(S(=O)(=O)C3CCCC3)cc2)CCCCC1 |
| InChI | InChI=1S/C20H29NO4S/c1-25-20(13-5-2-6-14-20)15-21-19(22)16-9-11-18(12-10-16)26(23,24)17-7-3-4-8-17/h9-12,17H,2-8,13-15H2,1H3,(H,21,22) |
| InChIKey | HSQZWHDPNMZTQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |