C8H9F2N3O2 — CID 126790708
1-[(3,3-difluorocyclobutyl)methyl]-4-nitropyrazole (PubChem CID 126790708) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.17 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclobutyl)methyl]-4-nitropyrazole.
| Compound Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-nitropyrazole |
|---|---|
| PubChem CID | 126790708 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-nitropyrazole |
| SMILES | O=[N+]([O-])c1cnn(CC2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C8H9F2N3O2/c9-8(10)1-6(2-8)4-12-5-7(3-11-12)13(14)15/h3,5-6H,1-2,4H2 |
| InChIKey | CTOUOSLKYFINEQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|