About 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile
3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile (PubChem CID 126790730) has the molecular formula C11H8F2N2O
and a molecular weight of 222.19 g/mol. Its IUPAC name is 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile |
| PubChem CID | 126790730 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile |
| SMILES | N#CCC(=O)N1CCc2ccc(F)c(F)c21 |
| InChI | InChI=1S/C11H8F2N2O/c12-8-2-1-7-4-6-15(9(16)3-5-14)11(7)10(8)13/h1-2H,3-4,6H2 |
| InChIKey | LCGCGDMBYPOMBN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile?
The IUPAC name of 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile (CID 126790730) is 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile.
What is the SMILES notation for 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile?
The canonical SMILES for 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile is N#CCC(=O)N1CCc2ccc(F)c(F)c21.
What is the InChIKey of 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile?
The InChIKey is LCGCGDMBYPOMBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O/c12-8-2-1-7-4-6-15(9(16)3-5-14)11(7)10(8)13/h1-2H,3-4,6H2.
What are the key properties of 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile?
3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile has a molecular weight of 222.19 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-difluoro-2,3-dihydroindol-1-yl)-3-oxopropanenitrile is sourced from PubChem (CID 126790730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).