C10H9Cl2NO — CID 166404156
2-chloro-1-(7-chloro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 166404156) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 2-chloro-1-(7-chloro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-chloro-1-(7-chloro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 166404156 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-chloro-1-(7-chloro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2cccc(Cl)c21 |
| InChI | InChI=1S/C10H9Cl2NO/c11-6-9(14)13-5-4-7-2-1-3-8(12)10(7)13/h1-3H,4-6H2 |
| InChIKey | CSLTYKSPNNBTGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|