C17H18N4O — CID 126792701
indolizin-2-yl-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 126792701) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is indolizin-2-yl-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | indolizin-2-yl-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 126792701 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | indolizin-2-yl-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cn1cc(C2CCN(C(=O)c3cc4ccccn4c3)C2)cn1 |
| InChI | InChI=1S/C17H18N4O/c1-19-10-15(9-18-19)13-5-7-21(11-13)17(22)14-8-16-4-2-3-6-20(16)12-14/h2-4,6,8-10,12-13H,5,7,11H2,1H3 |
| InChIKey | KTBCFBGVEHIABI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |