C11H16N2O4S — CID 126793066
6-ethoxy-4-(sulfamoylamino)-3,4-dihydro-2H-chromene (PubChem CID 126793066) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 6-ethoxy-4-(sulfamoylamino)-3,4-dihydro-2H-chromene.
| Compound Name | 6-ethoxy-4-(sulfamoylamino)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 126793066 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-ethoxy-4-(sulfamoylamino)-3,4-dihydro-2H-chromene |
| SMILES | CCOc1ccc2c(c1)C(NS(N)(=O)=O)CCO2 |
| InChI | InChI=1S/C11H16N2O4S/c1-2-16-8-3-4-11-9(7-8)10(5-6-17-11)13-18(12,14)15/h3-4,7,10,13H,2,5-6H2,1H3,(H2,12,14,15) |
| InChIKey | WEMZZTJEPGEOFJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |