C17H27N3O3S — CID 126793147
N-(cyclopropylmethyl)-6-[3-ethyl-3-(hydroxymethyl)piperidin-1-yl]pyridine-3-sulfonamide (PubChem CID 126793147) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-6-[3-ethyl-3-(hydroxymethyl)piperidin-1-yl]pyridine-3-sulfonamide.
| Compound Name | N-(cyclopropylmethyl)-6-[3-ethyl-3-(hydroxymethyl)piperidin-1-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 126793147 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-(cyclopropylmethyl)-6-[3-ethyl-3-(hydroxymethyl)piperidin-1-yl]pyridine-3-sulfonamide |
| SMILES | CCC1(CO)CCCN(c2ccc(S(=O)(=O)NCC3CC3)cn2)C1 |
| InChI | InChI=1S/C17H27N3O3S/c1-2-17(13-21)8-3-9-20(12-17)16-7-6-15(11-18-16)24(22,23)19-10-14-4-5-14/h6-7,11,14,19,21H,2-5,8-10,12-13H2,1H3 |
| InChIKey | VWSBOHBDDGZGDW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |