C17H21N3O4S — CID 133347151
N-(cyclopropylmethyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide (PubChem CID 133347151) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide.
| Compound Name | N-(cyclopropylmethyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133347151 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(cyclopropylmethyl)-6-[2-(furan-2-yl)morpholin-4-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CC1)c1ccc(N2CCOC(c3ccco3)C2)nc1 |
| InChI | InChI=1S/C17H21N3O4S/c21-25(22,19-10-13-3-4-13)14-5-6-17(18-11-14)20-7-9-24-16(12-20)15-2-1-8-23-15/h1-2,5-6,8,11,13,16,19H,3-4,7,9-10,12H2 |
| InChIKey | LPSUWELGRKUYCM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |