C13H14N4O3 — CID 133347306
6-[2-(furan-2-yl)morpholin-4-yl]pyridazine-3-carboxamide (PubChem CID 133347306) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-[2-(furan-2-yl)morpholin-4-yl]pyridazine-3-carboxamide.
| Compound Name | 6-[2-(furan-2-yl)morpholin-4-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133347306 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-[2-(furan-2-yl)morpholin-4-yl]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCOC(c3ccco3)C2)nn1 |
| InChI | InChI=1S/C13H14N4O3/c14-13(18)9-3-4-12(16-15-9)17-5-7-20-11(8-17)10-2-1-6-19-10/h1-4,6,11H,5,7-8H2,(H2,14,18) |
| InChIKey | CKCDPWHTSFBCBP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |