C18H26N2O4 — CID 126793235
3-[(1-cyclopentylpyrrole-2-carbonyl)-(oxan-4-yl)amino]propanoic acid (PubChem CID 126793235) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[(1-cyclopentylpyrrole-2-carbonyl)-(oxan-4-yl)amino]propanoic acid.
| Compound Name | 3-[(1-cyclopentylpyrrole-2-carbonyl)-(oxan-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 126793235 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-[(1-cyclopentylpyrrole-2-carbonyl)-(oxan-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)c1cccn1C1CCCC1)C1CCOCC1 |
| InChI | InChI=1S/C18H26N2O4/c21-17(22)7-11-20(15-8-12-24-13-9-15)18(23)16-6-3-10-19(16)14-4-1-2-5-14/h3,6,10,14-15H,1-2,4-5,7-9,11-13H2,(H,21,22) |
| InChIKey | GCHZOVGNUCCFPO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |