C9H15F2NS — CID 126793759
4-[(3,3-difluorocyclobutyl)methyl]thiomorpholine (PubChem CID 126793759) has the molecular formula C9H15F2NS and a molecular weight of 207.29 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclobutyl)methyl]thiomorpholine.
| Compound Name | 4-[(3,3-difluorocyclobutyl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 126793759 |
| Molecular Formula | C9H15F2NS |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-[(3,3-difluorocyclobutyl)methyl]thiomorpholine |
| SMILES | FC1(F)CC(CN2CCSCC2)C1 |
| InChI | InChI=1S/C9H15F2NS/c10-9(11)5-8(6-9)7-12-1-3-13-4-2-12/h8H,1-7H2 |
| InChIKey | DWQMFKBILBEBRK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |