C19H22F2N2O2S — CID 140539824
1-[(3,3-difluorocyclobutyl)methyl]-4-naphthalen-1-ylsulfonylpiperazine (PubChem CID 140539824) has the molecular formula C19H22F2N2O2S and a molecular weight of 380.46 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclobutyl)methyl]-4-naphthalen-1-ylsulfonylpiperazine.
| Compound Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-naphthalen-1-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 140539824 |
| Molecular Formula | C19H22F2N2O2S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[(3,3-difluorocyclobutyl)methyl]-4-naphthalen-1-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1cccc2ccccc12)N1CCN(CC2CC(F)(F)C2)CC1 |
| InChI | InChI=1S/C19H22F2N2O2S/c20-19(21)12-15(13-19)14-22-8-10-23(11-9-22)26(24,25)18-7-3-5-16-4-1-2-6-17(16)18/h1-7,15H,8-14H2 |
| InChIKey | NZVFWPHIXNXPCG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |