C14H12N2O4S — CID 114795554
4-naphthalen-1-ylsulfonylpiperazine-2,6-dione (PubChem CID 114795554) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-naphthalen-1-ylsulfonylpiperazine-2,6-dione.
| Compound Name | 4-naphthalen-1-ylsulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 114795554 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-naphthalen-1-ylsulfonylpiperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)c2cccc3ccccc23)CC(=O)N1 |
| InChI | InChI=1S/C14H12N2O4S/c17-13-8-16(9-14(18)15-13)21(19,20)12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H,15,17,18) |
| InChIKey | RAAWFHXNLZIGDS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|