C21H22FN3O2 — CID 126794316
4-(4-fluorophenoxy)-N-(1-methylindol-7-yl)piperidine-1-carboxamide (PubChem CID 126794316) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-(1-methylindol-7-yl)piperidine-1-carboxamide.
| Compound Name | 4-(4-fluorophenoxy)-N-(1-methylindol-7-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126794316 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-(1-methylindol-7-yl)piperidine-1-carboxamide |
| SMILES | Cn1ccc2cccc(NC(=O)N3CCC(Oc4ccc(F)cc4)CC3)c21 |
| InChI | InChI=1S/C21H22FN3O2/c1-24-12-9-15-3-2-4-19(20(15)24)23-21(26)25-13-10-18(11-14-25)27-17-7-5-16(22)6-8-17/h2-9,12,18H,10-11,13-14H2,1H3,(H,23,26) |
| InChIKey | KIRFQHGFSJMZRU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |