C18H19N3O2S — CID 124621987
(2R)-N-(1-methylindol-7-yl)-2-thiophen-3-ylmorpholine-4-carboxamide (PubChem CID 124621987) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is (2R)-N-(1-methylindol-7-yl)-2-thiophen-3-ylmorpholine-4-carboxamide.
| Compound Name | (2R)-N-(1-methylindol-7-yl)-2-thiophen-3-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 124621987 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2R)-N-(1-methylindol-7-yl)-2-thiophen-3-ylmorpholine-4-carboxamide |
| SMILES | Cn1ccc2cccc(NC(=O)N3CCO[C@H](c4ccsc4)C3)c21 |
| InChI | InChI=1S/C18H19N3O2S/c1-20-7-5-13-3-2-4-15(17(13)20)19-18(22)21-8-9-23-16(11-21)14-6-10-24-12-14/h2-7,10,12,16H,8-9,11H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | UJCXWUGBCBUPLY-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |