C17H17NO5S — CID 129466702
2-[3-[(2S)-2-thiophen-3-ylmorpholine-4-carbonyl]phenoxy]acetic acid (PubChem CID 129466702) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[3-[(2S)-2-thiophen-3-ylmorpholine-4-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(2S)-2-thiophen-3-ylmorpholine-4-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 129466702 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[3-[(2S)-2-thiophen-3-ylmorpholine-4-carbonyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(C(=O)N2CCO[C@@H](c3ccsc3)C2)c1 |
| InChI | InChI=1S/C17H17NO5S/c19-16(20)10-23-14-3-1-2-12(8-14)17(21)18-5-6-22-15(9-18)13-4-7-24-11-13/h1-4,7-8,11,15H,5-6,9-10H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | WJDNDDNKDXUPNO-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |