C24H21N3O4 — CID 126797593
N'-[3-[[3-(2-methoxyphenyl)-2-phenylprop-2-enoyl]amino]phenyl]oxamide (PubChem CID 126797593) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is N'-[3-[[3-(2-methoxyphenyl)-2-phenylprop-2-enoyl]amino]phenyl]oxamide.
| Compound Name | N'-[3-[[3-(2-methoxyphenyl)-2-phenylprop-2-enoyl]amino]phenyl]oxamide |
|---|---|
| PubChem CID | 126797593 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N'-[3-[[3-(2-methoxyphenyl)-2-phenylprop-2-enoyl]amino]phenyl]oxamide |
| SMILES | COc1ccccc1C=C(C(=O)Nc1cccc(NC(=O)C(N)=O)c1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4/c1-31-21-13-6-5-10-17(21)14-20(16-8-3-2-4-9-16)23(29)26-18-11-7-12-19(15-18)27-24(30)22(25)28/h2-15H,1H3,(H2,25,28)(H,26,29)(H,27,30) |
| InChIKey | JBSHAHIJKMMWHJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|