C18H25F2N5O — CID 126798019
5-[(3aS,6aS)-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 126798019) has the molecular formula C18H25F2N5O and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-[(3aS,6aS)-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(3aS,6aS)-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 126798019 |
| Molecular Formula | C18H25F2N5O |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 5-[(3aS,6aS)-2-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1noc([C@@]23CCC[C@@H]2CN(Cc2cnn(CC(F)F)c2)C3)n1 |
| InChI | InChI=1S/C18H25F2N5O/c1-12(2)16-22-17(26-23-16)18-5-3-4-14(18)9-24(11-18)7-13-6-21-25(8-13)10-15(19)20/h6,8,12,14-15H,3-5,7,9-11H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | MJVOARBQKGLEGY-RDTXWAMCSA-N |
| XLogP | 3.21 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |