C17H25N5O2S — CID 126798090
2-N-[(1-butylsulfonylpyrrolidin-3-yl)methyl]quinazoline-2,4-diamine (PubChem CID 126798090) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-N-[(1-butylsulfonylpyrrolidin-3-yl)methyl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[(1-butylsulfonylpyrrolidin-3-yl)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 126798090 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-N-[(1-butylsulfonylpyrrolidin-3-yl)methyl]quinazoline-2,4-diamine |
| SMILES | CCCCS(=O)(=O)N1CCC(CNc2nc(N)c3ccccc3n2)C1 |
| InChI | InChI=1S/C17H25N5O2S/c1-2-3-10-25(23,24)22-9-8-13(12-22)11-19-17-20-15-7-5-4-6-14(15)16(18)21-17/h4-7,13H,2-3,8-12H2,1H3,(H3,18,19,20,21) |
| InChIKey | CDSLMMBRIOQMDB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |