C26H30ClN5O3S — CID 141246475
[4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl-naphthalen-1-ylsulfamic acid;hydrochloride (PubChem CID 141246475) has the molecular formula C26H30ClN5O3S and a molecular weight of 528.08 g/mol. Its IUPAC name is [4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl-naphthalen-1-ylsulfamic acid;hydrochloride.
| Compound Name | [4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl-naphthalen-1-ylsulfamic acid;hydrochloride |
|---|---|
| PubChem CID | 141246475 |
| Molecular Formula | C26H30ClN5O3S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | [4-[[(4-aminoquinazolin-2-yl)amino]methyl]cyclohexyl]methyl-naphthalen-1-ylsulfamic acid;hydrochloride |
| SMILES | Cl.Nc1nc(NCC2CCC(CN(c3cccc4ccccc34)S(=O)(=O)O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H29N5O3S.ClH/c27-25-22-9-3-4-10-23(22)29-26(30-25)28-16-18-12-14-19(15-13-18)17-31(35(32,33)34)24-11-5-7-20-6-1-2-8-21(20)24;/h1-11,18-19H,12-17H2,(H,32,33,34)(H3,27,28,29,30);1H |
| InChIKey | PJLDIIVJEOBFMM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|