C17H23N5O — CID 126799165
N-(3-ethylphenyl)-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 126799165) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126799165 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(3-ethylphenyl)-2-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)CN2CCCCC2c2ncn[nH]2)c1 |
| InChI | InChI=1S/C17H23N5O/c1-2-13-6-5-7-14(10-13)20-16(23)11-22-9-4-3-8-15(22)17-18-12-19-21-17/h5-7,10,12,15H,2-4,8-9,11H2,1H3,(H,20,23)(H,18,19,21) |
| InChIKey | QIQMQCAKUABUAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |