C13H23N5O — CID 97253484
N-butyl-2-[(2R)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 97253484) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is N-butyl-2-[(2R)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-butyl-2-[(2R)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97253484 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-butyl-2-[(2R)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCCC[C@@H]1c1ncn[nH]1 |
| InChI | InChI=1S/C13H23N5O/c1-2-3-7-14-12(19)9-18-8-5-4-6-11(18)13-15-10-16-17-13/h10-11H,2-9H2,1H3,(H,14,19)(H,15,16,17)/t11-/m1/s1 |
| InChIKey | OYNHCNJXQWXWIZ-LLVKDONJSA-N |
| XLogP | 1.25 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|