C16H21FN4O2 — CID 126799900
4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N'-(4-fluorophenyl)butanehydrazide (PubChem CID 126799900) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N'-(4-fluorophenyl)butanehydrazide.
| Compound Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N'-(4-fluorophenyl)butanehydrazide |
|---|---|
| PubChem CID | 126799900 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N'-(4-fluorophenyl)butanehydrazide |
| SMILES | CC(C)(C)c1noc(CCCC(=O)NNc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H21FN4O2/c1-16(2,3)15-18-14(23-21-15)6-4-5-13(22)20-19-12-9-7-11(17)8-10-12/h7-10,19H,4-6H2,1-3H3,(H,20,22) |
| InChIKey | SVXAKRLJZSZFSA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|