C11H11ClN4OS2 — CID 126801216
3-chloro-N'-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methoxy]benzenecarboximidamide (PubChem CID 126801216) has the molecular formula C11H11ClN4OS2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-chloro-N'-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methoxy]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 126801216 |
| Molecular Formula | C11H11ClN4OS2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 3-chloro-N'-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)methoxy]benzenecarboximidamide |
| SMILES | CSc1nnc(CON=C(N)c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C11H11ClN4OS2/c1-18-11-15-14-9(19-11)6-17-16-10(13)7-3-2-4-8(12)5-7/h2-5H,6H2,1H3,(H2,13,16) |
| InChIKey | QKVMCZFQFCXNKP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|