C16H15BrN2O3 — CID 126801416
N-[3-(6-bromo-2,3-dihydroindol-1-yl)-3-oxopropyl]furan-2-carboxamide (PubChem CID 126801416) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is N-[3-(6-bromo-2,3-dihydroindol-1-yl)-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-(6-bromo-2,3-dihydroindol-1-yl)-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126801416 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-[3-(6-bromo-2,3-dihydroindol-1-yl)-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCc2ccc(Br)cc21)c1ccco1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-12-4-3-11-6-8-19(13(11)10-12)15(20)5-7-18-16(21)14-2-1-9-22-14/h1-4,9-10H,5-8H2,(H,18,21) |
| InChIKey | KLOAGKOZKPYIDL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |