C17H23FN2O2S — CID 126802422
1-butyl-2-[1-(2-fluorophenyl)ethylsulfonyl]-4,5-dimethylimidazole (PubChem CID 126802422) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-butyl-2-[1-(2-fluorophenyl)ethylsulfonyl]-4,5-dimethylimidazole.
| Compound Name | 1-butyl-2-[1-(2-fluorophenyl)ethylsulfonyl]-4,5-dimethylimidazole |
|---|---|
| PubChem CID | 126802422 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-butyl-2-[1-(2-fluorophenyl)ethylsulfonyl]-4,5-dimethylimidazole |
| SMILES | CCCCn1c(S(=O)(=O)C(C)c2ccccc2F)nc(C)c1C |
| InChI | InChI=1S/C17H23FN2O2S/c1-5-6-11-20-13(3)12(2)19-17(20)23(21,22)14(4)15-9-7-8-10-16(15)18/h7-10,14H,5-6,11H2,1-4H3 |
| InChIKey | FPPFKEKMRJWEIL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |