C20H29N3OS — CID 75868884
N-benzyl-2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanylbutanamide (PubChem CID 75868884) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is N-benzyl-2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanylbutanamide.
| Compound Name | N-benzyl-2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 75868884 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-benzyl-2-(1-butyl-4,5-dimethylimidazol-2-yl)sulfanylbutanamide |
| SMILES | CCCCn1c(SC(CC)C(=O)NCc2ccccc2)nc(C)c1C |
| InChI | InChI=1S/C20H29N3OS/c1-5-7-13-23-16(4)15(3)22-20(23)25-18(6-2)19(24)21-14-17-11-9-8-10-12-17/h8-12,18H,5-7,13-14H2,1-4H3,(H,21,24) |
| InChIKey | NQKMNLXFUSAHLZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |