C19H21N3O2S2 — CID 46567831
N-benzyl-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylbutanamide (PubChem CID 46567831) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-benzyl-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylbutanamide.
| Compound Name | N-benzyl-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46567831 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-benzyl-2-(3-ethyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1nc2ccsc2c(=O)n1CC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-3-15(17(23)20-12-13-8-6-5-7-9-13)26-19-21-14-10-11-25-16(14)18(24)22(19)4-2/h5-11,15H,3-4,12H2,1-2H3,(H,20,23) |
| InChIKey | BJMJUDJYCWJHBL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |