C17H19N5O2 — CID 126808000
[5-(furan-2-yl)-1H-pyrazol-3-yl]-[4-(5-methyl-1H-pyrazol-4-yl)piperidin-1-yl]methanone (PubChem CID 126808000) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is [5-(furan-2-yl)-1H-pyrazol-3-yl]-[4-(5-methyl-1H-pyrazol-4-yl)piperidin-1-yl]methanone.
| Compound Name | [5-(furan-2-yl)-1H-pyrazol-3-yl]-[4-(5-methyl-1H-pyrazol-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126808000 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [5-(furan-2-yl)-1H-pyrazol-3-yl]-[4-(5-methyl-1H-pyrazol-4-yl)piperidin-1-yl]methanone |
| SMILES | Cc1[nH]ncc1C1CCN(C(=O)c2cc(-c3ccco3)[nH]n2)CC1 |
| InChI | InChI=1S/C17H19N5O2/c1-11-13(10-18-19-11)12-4-6-22(7-5-12)17(23)15-9-14(20-21-15)16-3-2-8-24-16/h2-3,8-10,12H,4-7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | LHHMNIVKVLNGIN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |