C19H24ClN5O2 — CID 126808058
2-[[amino-[5-(tert-butylamino)-2-pyridinyl]methylidene]amino]oxy-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 126808058) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 2-[[amino-[5-(tert-butylamino)-2-pyridinyl]methylidene]amino]oxy-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[[amino-[5-(tert-butylamino)-2-pyridinyl]methylidene]amino]oxy-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 126808058 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-[[amino-[5-(tert-butylamino)-2-pyridinyl]methylidene]amino]oxy-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | CC(C)(C)Nc1ccc(C(N)=NOCC(=O)NCc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C19H24ClN5O2/c1-19(2,3)24-15-8-9-16(22-11-15)18(21)25-27-12-17(26)23-10-13-4-6-14(20)7-5-13/h4-9,11,24H,10,12H2,1-3H3,(H2,21,25)(H,23,26) |
| InChIKey | NJQRGEQPNKVLCG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|