C20H15ClFN3O3 — CID 151834558
[5-[5-[(4-chlorophenyl)methylamino]pyridine-2-carbonyl]-2-fluorophenyl] carbamate (PubChem CID 151834558) has the molecular formula C20H15ClFN3O3 and a molecular weight of 399.81 g/mol. Its IUPAC name is [5-[5-[(4-chlorophenyl)methylamino]pyridine-2-carbonyl]-2-fluorophenyl] carbamate.
| Compound Name | [5-[5-[(4-chlorophenyl)methylamino]pyridine-2-carbonyl]-2-fluorophenyl] carbamate |
|---|---|
| PubChem CID | 151834558 |
| Molecular Formula | C20H15ClFN3O3 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [5-[5-[(4-chlorophenyl)methylamino]pyridine-2-carbonyl]-2-fluorophenyl] carbamate |
| SMILES | NC(=O)Oc1cc(C(=O)c2ccc(NCc3ccc(Cl)cc3)cn2)ccc1F |
| InChI | InChI=1S/C20H15ClFN3O3/c21-14-4-1-12(2-5-14)10-24-15-6-8-17(25-11-15)19(26)13-3-7-16(22)18(9-13)28-20(23)27/h1-9,11,24H,10H2,(H2,23,27) |
| InChIKey | SFJOLVSQIIXBRL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |