C18H25F2N3O2 — CID 126808092
N-[4-[2-(difluoromethyl)piperazine-1-carbonyl]-2-methylphenyl]-3-methylbutanamide (PubChem CID 126808092) has the molecular formula C18H25F2N3O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is N-[4-[2-(difluoromethyl)piperazine-1-carbonyl]-2-methylphenyl]-3-methylbutanamide.
| Compound Name | N-[4-[2-(difluoromethyl)piperazine-1-carbonyl]-2-methylphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 126808092 |
| Molecular Formula | C18H25F2N3O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[4-[2-(difluoromethyl)piperazine-1-carbonyl]-2-methylphenyl]-3-methylbutanamide |
| SMILES | Cc1cc(C(=O)N2CCNCC2C(F)F)ccc1NC(=O)CC(C)C |
| InChI | InChI=1S/C18H25F2N3O2/c1-11(2)8-16(24)22-14-5-4-13(9-12(14)3)18(25)23-7-6-21-10-15(23)17(19)20/h4-5,9,11,15,17,21H,6-8,10H2,1-3H3,(H,22,24) |
| InChIKey | LFNADVQOGRPVRV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |