C18H25ClFN3O2 — CID 120655767
N-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-fluorophenyl]-3-methylbutanamide;hydrochloride (PubChem CID 120655767) has the molecular formula C18H25ClFN3O2 and a molecular weight of 369.87 g/mol. Its IUPAC name is N-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-fluorophenyl]-3-methylbutanamide;hydrochloride.
| Compound Name | N-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-fluorophenyl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120655767 |
| Molecular Formula | C18H25ClFN3O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-fluorophenyl]-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)N2C[C@H]3CNC[C@H]3C2)cc1F.Cl |
| InChI | InChI=1S/C18H24FN3O2.ClH/c1-11(2)5-17(23)21-16-4-3-12(6-15(16)19)18(24)22-9-13-7-20-8-14(13)10-22;/h3-4,6,11,13-14,20H,5,7-10H2,1-2H3,(H,21,23);1H/t13-,14+; |
| InChIKey | XSVIJOVFJJRNDG-KAECKJJSSA-N |
| XLogP | 2.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |