C21H24FN5O3 — CID 126808335
N-(4-fluorophenyl)-2-[[2-[2-(N'-hydroxycarbamimidoyl)piperidin-1-yl]acetyl]amino]benzamide (PubChem CID 126808335) has the molecular formula C21H24FN5O3 and a molecular weight of 413.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[2-[2-(N'-hydroxycarbamimidoyl)piperidin-1-yl]acetyl]amino]benzamide.
| Compound Name | N-(4-fluorophenyl)-2-[[2-[2-(N'-hydroxycarbamimidoyl)piperidin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126808335 |
| Molecular Formula | C21H24FN5O3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[2-[2-(N'-hydroxycarbamimidoyl)piperidin-1-yl]acetyl]amino]benzamide |
| SMILES | NC(=NO)C1CCCCN1CC(=O)Nc1ccccc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN5O3/c22-14-8-10-15(11-9-14)24-21(29)16-5-1-2-6-17(16)25-19(28)13-27-12-4-3-7-18(27)20(23)26-30/h1-2,5-6,8-11,18,30H,3-4,7,12-13H2,(H2,23,26)(H,24,29)(H,25,28) |
| InChIKey | AUDBFWVIYOZAOF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|