About 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one
9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one (PubChem CID 126808434) has the molecular formula C18H22F2N2O
and a molecular weight of 320.38 g/mol. Its IUPAC name is 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one.
Molecular Properties
| Compound Name | 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one |
| PubChem CID | 126808434 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one |
| SMILES | O=C1CCC(NC2CC(c3cc(F)cc(F)c3)C2)C2(CCC2)N1 |
| InChI | InChI=1S/C18H22F2N2O/c19-13-6-11(7-14(20)10-13)12-8-15(9-12)21-16-2-3-17(23)22-18(16)4-1-5-18/h6-7,10,12,15-16,21H,1-5,8-9H2,(H,22,23) |
| InChIKey | CAIFTWBHVFPYKL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one?
The IUPAC name of 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one (CID 126808434) is 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one.
What is the SMILES notation for 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one?
The canonical SMILES for 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one is O=C1CCC(NC2CC(c3cc(F)cc(F)c3)C2)C2(CCC2)N1.
What is the InChIKey of 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one?
The InChIKey is CAIFTWBHVFPYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O/c19-13-6-11(7-14(20)10-13)12-8-15(9-12)21-16-2-3-17(23)22-18(16)4-1-5-18/h6-7,10,12,15-16,21H,1-5,8-9H2,(H,22,23).
What are the key properties of 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one?
9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one has a molecular weight of 320.38 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[[3-(3,5-difluorophenyl)cyclobutyl]amino]-5-azaspiro[3.5]nonan-6-one is sourced from PubChem (CID 126808434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).