C17H28N2O4S — CID 126808932
1-[4-(2-methoxy-5-methylphenyl)sulfonyl-3-methylpiperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 126808932) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[4-(2-methoxy-5-methylphenyl)sulfonyl-3-methylpiperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-(2-methoxy-5-methylphenyl)sulfonyl-3-methylpiperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 126808932 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[4-(2-methoxy-5-methylphenyl)sulfonyl-3-methylpiperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCN(CC(C)(C)O)CC1C |
| InChI | InChI=1S/C17H28N2O4S/c1-13-6-7-15(23-5)16(10-13)24(21,22)19-9-8-18(11-14(19)2)12-17(3,4)20/h6-7,10,14,20H,8-9,11-12H2,1-5H3 |
| InChIKey | POEQOBUBSBQKFM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |