C15H21F3N2O3S — CID 136534004
2-methyl-1-[3-methyl-4-(2,4,5-trifluorophenyl)sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 136534004) has the molecular formula C15H21F3N2O3S and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-methyl-1-[3-methyl-4-(2,4,5-trifluorophenyl)sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[3-methyl-4-(2,4,5-trifluorophenyl)sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 136534004 |
| Molecular Formula | C15H21F3N2O3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-methyl-1-[3-methyl-4-(2,4,5-trifluorophenyl)sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | CC1CN(CC(C)(C)O)CCN1S(=O)(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H21F3N2O3S/c1-10-8-19(9-15(2,3)21)4-5-20(10)24(22,23)14-7-12(17)11(16)6-13(14)18/h6-7,10,21H,4-5,8-9H2,1-3H3 |
| InChIKey | SLEXZOSOYTUROQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|