C19H25FN4O — CID 133486579
1-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methylpiperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 133486579) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methylpiperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methylpiperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 133486579 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methylpiperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | CC1CN(CC(C)(C)O)CCN1c1ccc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C19H25FN4O/c1-14-12-23(13-19(2,3)25)10-11-24(14)18-9-8-17(21-22-18)15-4-6-16(20)7-5-15/h4-9,14,25H,10-13H2,1-3H3 |
| InChIKey | DVABFCNZMFMHGY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |