C9H10N2OS — CID 126809551
N'-but-2-ynoxythiophene-2-carboximidamide (PubChem CID 126809551) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is N'-but-2-ynoxythiophene-2-carboximidamide.
| Compound Name | N'-but-2-ynoxythiophene-2-carboximidamide |
|---|---|
| PubChem CID | 126809551 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | N'-but-2-ynoxythiophene-2-carboximidamide |
| SMILES | CC#CCON=C(N)c1cccs1 |
| InChI | InChI=1S/C9H10N2OS/c1-2-3-6-12-11-9(10)8-5-4-7-13-8/h4-5,7H,6H2,1H3,(H2,10,11) |
| InChIKey | LBVIHYCRQCWKBQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|