C11H12N4O2S — CID 19296308
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-ethylpyrazole-4-carboxylate (PubChem CID 19296308) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-ethylpyrazole-4-carboxylate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-ethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19296308 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 1-ethylpyrazole-4-carboxylate |
| SMILES | CCn1cc(C(=O)O/N=C(\N)c2cccs2)cn1 |
| InChI | InChI=1S/C11H12N4O2S/c1-2-15-7-8(6-13-15)11(16)17-14-10(12)9-4-3-5-18-9/h3-7H,2H2,1H3,(H2,12,14) |
| InChIKey | NFYSATPKWUFWTM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|