C11H9ClN2O3S2 — CID 2819013
[[amino(thiophen-2-yl)methylidene]amino] 5-chloro-4-methoxythiophene-3-carboxylate (PubChem CID 2819013) has the molecular formula C11H9ClN2O3S2 and a molecular weight of 316.79 g/mol. Its IUPAC name is [[amino(thiophen-2-yl)methylidene]amino] 5-chloro-4-methoxythiophene-3-carboxylate.
| Compound Name | [[amino(thiophen-2-yl)methylidene]amino] 5-chloro-4-methoxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 2819013 |
| Molecular Formula | C11H9ClN2O3S2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | [[amino(thiophen-2-yl)methylidene]amino] 5-chloro-4-methoxythiophene-3-carboxylate |
| SMILES | COc1c(C(=O)ON=C(N)c2cccs2)csc1Cl |
| InChI | InChI=1S/C11H9ClN2O3S2/c1-16-8-6(5-19-9(8)12)11(15)17-14-10(13)7-3-2-4-18-7/h2-5H,1H3,(H2,13,14) |
| InChIKey | VKZHRRODXCIMAG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|