C10H6Br2N2O2S2 — CID 19296359
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 4,5-dibromothiophene-2-carboxylate (PubChem CID 19296359) has the molecular formula C10H6Br2N2O2S2 and a molecular weight of 410.11 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19296359 |
| Molecular Formula | C10H6Br2N2O2S2 |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.82 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4,5-dibromothiophene-2-carboxylate |
| SMILES | N/C(=N\OC(=O)c1cc(Br)c(Br)s1)c1cccs1 |
| InChI | InChI=1S/C10H6Br2N2O2S2/c11-5-4-7(18-8(5)12)10(15)16-14-9(13)6-2-1-3-17-6/h1-4H,(H2,13,14) |
| InChIKey | IFAZDJSDCBAJLO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|