About [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate
[(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate (PubChem CID 6233145) has the molecular formula C14H12BrNO2S
and a molecular weight of 338.23 g/mol. Its IUPAC name is [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate.
Molecular Properties
| Compound Name | [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate |
| PubChem CID | 6233145 |
| Molecular Formula | C14H12BrNO2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate |
| SMILES | C/C(=N/OC(=O)c1ccc(C)c(Br)c1)c1cccs1 |
| InChI | InChI=1S/C14H12BrNO2S/c1-9-5-6-11(8-12(9)15)14(17)18-16-10(2)13-4-3-7-19-13/h3-8H,1-2H3/b16-10- |
| InChIKey | QZZPDXPKQHGRDR-YBEGLDIGSA-N |
| XLogP | 4.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate?
The IUPAC name of [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate (CID 6233145) is [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate.
What is the SMILES notation for [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate?
The canonical SMILES for [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate is C/C(=N/OC(=O)c1ccc(C)c(Br)c1)c1cccs1.
What is the InChIKey of [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate?
The InChIKey is QZZPDXPKQHGRDR-YBEGLDIGSA-N. The full InChI is InChI=1S/C14H12BrNO2S/c1-9-5-6-11(8-12(9)15)14(17)18-16-10(2)13-4-3-7-19-13/h3-8H,1-2H3/b16-10-.
What are the key properties of [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate?
[(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate has a molecular weight of 338.23 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-thiophen-2-ylethylideneamino] 3-bromo-4-methylbenzoate is sourced from PubChem (CID 6233145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).