C19H23NO5S — CID 6160907
[(Z)-1-thiophen-2-ylethylideneamino] 3,4,5-triethoxybenzoate (PubChem CID 6160907) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is [(Z)-1-thiophen-2-ylethylideneamino] 3,4,5-triethoxybenzoate.
| Compound Name | [(Z)-1-thiophen-2-ylethylideneamino] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 6160907 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(Z)-1-thiophen-2-ylethylideneamino] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)O/N=C(/C)c2cccs2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H23NO5S/c1-5-22-15-11-14(12-16(23-6-2)18(15)24-7-3)19(21)25-20-13(4)17-9-8-10-26-17/h8-12H,5-7H2,1-4H3/b20-13- |
| InChIKey | MZVRPCKLJGAHFE-MOSHPQCFSA-N |
| XLogP | 4.53 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|