C15H14F2N2O4S — CID 19324251
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-(difluoromethoxy)-3-ethoxybenzoate (PubChem CID 19324251) has the molecular formula C15H14F2N2O4S and a molecular weight of 356.35 g/mol. Its IUPAC name is [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-(difluoromethoxy)-3-ethoxybenzoate.
| Compound Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-(difluoromethoxy)-3-ethoxybenzoate |
|---|---|
| PubChem CID | 19324251 |
| Molecular Formula | C15H14F2N2O4S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-(difluoromethoxy)-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)O/N=C(\N)c2cccs2)ccc1OC(F)F |
| InChI | InChI=1S/C15H14F2N2O4S/c1-2-21-11-8-9(5-6-10(11)22-15(16)17)14(20)23-19-13(18)12-4-3-7-24-12/h3-8,15H,2H2,1H3,(H2,18,19) |
| InChIKey | REXAVUPYWFUZRK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|